C17H21ClN4 — CID 22320471
1-(4-chlorobutyl)-2-propylimidazo[4,5-c]quinolin-4-amine (PubChem CID 22320471) has the molecular formula C17H21ClN4 and a molecular weight of 316.84 g/mol. Its IUPAC name is 1-(4-chlorobutyl)-2-propylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-(4-chlorobutyl)-2-propylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 22320471 |
| Molecular Formula | C17H21ClN4 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-(4-chlorobutyl)-2-propylimidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCc1nc2c(N)nc3ccccc3c2n1CCCCCl |
| InChI | InChI=1S/C17H21ClN4/c1-2-7-14-21-15-16(22(14)11-6-5-10-18)12-8-3-4-9-13(12)20-17(15)19/h3-4,8-9H,2,5-7,10-11H2,1H3,(H2,19,20) |
| InChIKey | CKXWVSJZKGUQJM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|