C19H26N6O2 — CID 58869094
1-[4-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)butyl]-1-methoxyurea (PubChem CID 58869094) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 1-[4-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)butyl]-1-methoxyurea.
| Compound Name | 1-[4-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)butyl]-1-methoxyurea |
|---|---|
| PubChem CID | 58869094 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[4-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)butyl]-1-methoxyurea |
| SMILES | CCCc1nc2c(N)nc3ccccc3c2n1CCCCN(OC)C(N)=O |
| InChI | InChI=1S/C19H26N6O2/c1-3-8-15-23-16-17(13-9-4-5-10-14(13)22-18(16)20)24(15)11-6-7-12-25(27-2)19(21)26/h4-5,9-10H,3,6-8,11-12H2,1-2H3,(H2,20,22)(H2,21,26) |
| InChIKey | CFCMVEYOSILFRF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|