C24H28N6O2 — CID 58869112
N-[4-(4-amino-2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-N-methoxybenzamide (PubChem CID 58869112) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N-[4-(4-amino-2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-N-methoxybenzamide.
| Compound Name | N-[4-(4-amino-2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-N-methoxybenzamide |
|---|---|
| PubChem CID | 58869112 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | N-[4-(4-amino-2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-N-methoxybenzamide |
| SMILES | CCCc1nc2c(N)nc3cccnc3c2n1CCCCN(OC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28N6O2/c1-3-10-19-28-21-22(20-18(27-23(21)25)13-9-14-26-20)29(19)15-7-8-16-30(32-2)24(31)17-11-5-4-6-12-17/h4-6,9,11-14H,3,7-8,10,15-16H2,1-2H3,(H2,25,27) |
| InChIKey | AMZGTMZZAUQLLY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|