C16H22N6 — CID 155067176
2-ethyl-1-[4-(methylamino)butyl]imidazo[4,5-c][1,5]naphthyridin-4-amine (PubChem CID 155067176) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-ethyl-1-[4-(methylamino)butyl]imidazo[4,5-c][1,5]naphthyridin-4-amine.
| Compound Name | 2-ethyl-1-[4-(methylamino)butyl]imidazo[4,5-c][1,5]naphthyridin-4-amine |
|---|---|
| PubChem CID | 155067176 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-ethyl-1-[4-(methylamino)butyl]imidazo[4,5-c][1,5]naphthyridin-4-amine |
| SMILES | CCc1nc2c(N)nc3cccnc3c2n1CCCCNC |
| InChI | InChI=1S/C16H22N6/c1-3-12-21-14-15(22(12)10-5-4-8-18-2)13-11(20-16(14)17)7-6-9-19-13/h6-7,9,18H,3-5,8,10H2,1-2H3,(H2,17,20) |
| InChIKey | LIWMPUWFAZDFRO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|