C26H31N7O — CID 154682588
N-[4-(4-amino-2-ethylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-4-pyrrolidin-1-ylbenzamide (PubChem CID 154682588) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[4-(4-amino-2-ethylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[4-(4-amino-2-ethylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 154682588 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | N-[4-(4-amino-2-ethylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-4-pyrrolidin-1-ylbenzamide |
| SMILES | CCc1nc2c(N)nc3cccnc3c2n1CCCCNC(=O)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C26H31N7O/c1-2-21-31-23-24(22-20(30-25(23)27)8-7-14-28-22)33(21)17-4-3-13-29-26(34)18-9-11-19(12-10-18)32-15-5-6-16-32/h7-12,14H,2-6,13,15-17H2,1H3,(H2,27,30)(H,29,34) |
| InChIKey | ZRPSFMUJJUWTSY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|