C24H29N7O3 — CID 162737189
4-amino-N-[4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]butyl]-3-methoxybenzamide (PubChem CID 162737189) has the molecular formula C24H29N7O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is 4-amino-N-[4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]butyl]-3-methoxybenzamide.
| Compound Name | 4-amino-N-[4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]butyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 162737189 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 4-amino-N-[4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]butyl]-3-methoxybenzamide |
| SMILES | CCOCc1nc2c(N)nc3cccnc3c2n1CCCCNC(=O)c1ccc(N)c(OC)c1 |
| InChI | InChI=1S/C24H29N7O3/c1-3-34-14-19-30-21-22(20-17(29-23(21)26)7-6-11-27-20)31(19)12-5-4-10-28-24(32)15-8-9-16(25)18(13-15)33-2/h6-9,11,13H,3-5,10,12,14,25H2,1-2H3,(H2,26,29)(H,28,32) |
| InChIKey | OHORTKVHTAAZRI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 143.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|