C22H33N7O3 — CID 58869102
1-[5-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]pentan-2-yl]-1-methoxy-3-propan-2-ylurea (PubChem CID 58869102) has the molecular formula C22H33N7O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-[5-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]pentan-2-yl]-1-methoxy-3-propan-2-ylurea.
| Compound Name | 1-[5-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]pentan-2-yl]-1-methoxy-3-propan-2-ylurea |
|---|---|
| PubChem CID | 58869102 |
| Molecular Formula | C22H33N7O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 1-[5-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]pentan-2-yl]-1-methoxy-3-propan-2-ylurea |
| SMILES | CCOCc1nc2c(N)nc3cccnc3c2n1CCCC(C)N(OC)C(=O)NC(C)C |
| InChI | InChI=1S/C22H33N7O3/c1-6-32-13-17-27-19-20(18-16(26-21(19)23)10-7-11-24-18)28(17)12-8-9-15(4)29(31-5)22(30)25-14(2)3/h7,10-11,14-15H,6,8-9,12-13H2,1-5H3,(H2,23,26)(H,25,30) |
| InChIKey | OIJIYLYKHASXEI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|