C16H22N6O3S — CID 68999199
4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]butane-1-sulfonamide (PubChem CID 68999199) has the molecular formula C16H22N6O3S and a molecular weight of 378.46 g/mol. Its IUPAC name is 4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]butane-1-sulfonamide.
| Compound Name | 4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 68999199 |
| Molecular Formula | C16H22N6O3S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]butane-1-sulfonamide |
| SMILES | CCOCc1nc2c(N)nc3cccnc3c2n1CCCCS(N)(=O)=O |
| InChI | InChI=1S/C16H22N6O3S/c1-2-25-10-12-21-14-15(22(12)8-3-4-9-26(18,23)24)13-11(20-16(14)17)6-5-7-19-13/h5-7H,2-4,8-10H2,1H3,(H2,17,20)(H2,18,23,24) |
| InChIKey | IENGWLYQEZICJO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 139.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|