C23H28N6O3S — CID 68820164
5-[4-amino-2-(ethoxymethyl)-7-pyridin-3-ylimidazo[4,5-c]quinolin-1-yl]pentane-1-sulfonamide (PubChem CID 68820164) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is 5-[4-amino-2-(ethoxymethyl)-7-pyridin-3-ylimidazo[4,5-c]quinolin-1-yl]pentane-1-sulfonamide.
| Compound Name | 5-[4-amino-2-(ethoxymethyl)-7-pyridin-3-ylimidazo[4,5-c]quinolin-1-yl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 68820164 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 5-[4-amino-2-(ethoxymethyl)-7-pyridin-3-ylimidazo[4,5-c]quinolin-1-yl]pentane-1-sulfonamide |
| SMILES | CCOCc1nc2c(N)nc3cc(-c4cccnc4)ccc3c2n1CCCCCS(N)(=O)=O |
| InChI | InChI=1S/C23H28N6O3S/c1-2-32-15-20-28-21-22(29(20)11-4-3-5-12-33(25,30)31)18-9-8-16(13-19(18)27-23(21)24)17-7-6-10-26-14-17/h6-10,13-14H,2-5,11-12,15H2,1H3,(H2,24,27)(H2,25,30,31) |
| InChIKey | AGYIYWWPVKLSSI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 139.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|