C22H25N5 — CID 173204364
1-butyl-2-propyl-7-pyridin-3-ylimidazo[4,5-c]quinolin-4-amine (PubChem CID 173204364) has the molecular formula C22H25N5 and a molecular weight of 359.48 g/mol. Its IUPAC name is 1-butyl-2-propyl-7-pyridin-3-ylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-butyl-2-propyl-7-pyridin-3-ylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 173204364 |
| Molecular Formula | C22H25N5 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-butyl-2-propyl-7-pyridin-3-ylimidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCn1c(CCC)nc2c(N)nc3cc(-c4cccnc4)ccc3c21 |
| InChI | InChI=1S/C22H25N5/c1-3-5-12-27-19(7-4-2)26-20-21(27)17-10-9-15(13-18(17)25-22(20)23)16-8-6-11-24-14-16/h6,8-11,13-14H,3-5,7,12H2,1-2H3,(H2,23,25) |
| InChIKey | KVUPTPBVNYIXFY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |