C17H23N5 — CID 175027745
1-butyl-2-(ethylaminomethyl)imidazo[4,5-c]quinolin-4-amine (PubChem CID 175027745) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 1-butyl-2-(ethylaminomethyl)imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-butyl-2-(ethylaminomethyl)imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 175027745 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 1-butyl-2-(ethylaminomethyl)imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCn1c(CNCC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C17H23N5/c1-3-5-10-22-14(11-19-4-2)21-15-16(22)12-8-6-7-9-13(12)20-17(15)18/h6-9,19H,3-5,10-11H2,1-2H3,(H2,18,20) |
| InChIKey | KXEOZCJBTSNTSV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |