C17H24N4 — CID 143284639
ethane;2-ethyl-1-propylimidazo[4,5-c]quinolin-4-amine (PubChem CID 143284639) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is ethane;2-ethyl-1-propylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | ethane;2-ethyl-1-propylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 143284639 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | ethane;2-ethyl-1-propylimidazo[4,5-c]quinolin-4-amine |
| SMILES | CC.CCCn1c(CC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C15H18N4.C2H6/c1-3-9-19-12(4-2)18-13-14(19)10-7-5-6-8-11(10)17-15(13)16;1-2/h5-8H,3-4,9H2,1-2H3,(H2,16,17);1-2H3 |
| InChIKey | TZRQGSKGQFOTIU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |