C20H28N4S — CID 10309036
1-(4-butylsulfanylbutyl)-2-ethylimidazo[4,5-c]quinolin-4-amine (PubChem CID 10309036) has the molecular formula C20H28N4S and a molecular weight of 356.54 g/mol. Its IUPAC name is 1-(4-butylsulfanylbutyl)-2-ethylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-(4-butylsulfanylbutyl)-2-ethylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 10309036 |
| Molecular Formula | C20H28N4S |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-(4-butylsulfanylbutyl)-2-ethylimidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCSCCCCn1c(CC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C20H28N4S/c1-3-5-13-25-14-9-8-12-24-17(4-2)23-18-19(24)15-10-6-7-11-16(15)22-20(18)21/h6-7,10-11H,3-5,8-9,12-14H2,1-2H3,(H2,21,22) |
| InChIKey | OEHZFBFYCHNCLU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|