C20H27N5S — CID 138461549
2-ethyl-1-[4-[methyl(thietan-3-yl)amino]butyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 138461549) has the molecular formula C20H27N5S and a molecular weight of 369.54 g/mol. Its IUPAC name is 2-ethyl-1-[4-[methyl(thietan-3-yl)amino]butyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-ethyl-1-[4-[methyl(thietan-3-yl)amino]butyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 138461549 |
| Molecular Formula | C20H27N5S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-ethyl-1-[4-[methyl(thietan-3-yl)amino]butyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCc1nc2c(N)nc3ccccc3c2n1CCCCN(C)C1CSC1 |
| InChI | InChI=1S/C20H27N5S/c1-3-17-23-18-19(15-8-4-5-9-16(15)22-20(18)21)25(17)11-7-6-10-24(2)14-12-26-13-14/h4-5,8-9,14H,3,6-7,10-13H2,1-2H3,(H2,21,22) |
| InChIKey | XSFHYNBCXLDYPH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|