C18H23N5 — CID 154682639
1-[4-(ethenylamino)butyl]-2-ethylimidazo[4,5-c]quinolin-4-amine (PubChem CID 154682639) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 1-[4-(ethenylamino)butyl]-2-ethylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[4-(ethenylamino)butyl]-2-ethylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 154682639 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 1-[4-(ethenylamino)butyl]-2-ethylimidazo[4,5-c]quinolin-4-amine |
| SMILES | C=CNCCCCn1c(CC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C18H23N5/c1-3-15-22-16-17(23(15)12-8-7-11-20-4-2)13-9-5-6-10-14(13)21-18(16)19/h4-6,9-10,20H,2-3,7-8,11-12H2,1H3,(H2,19,21) |
| InChIKey | SVCFPSBPASLOFV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|