C25H28F2N6O — CID 162372952
N-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-4-(dimethylamino)-3,5-difluorobenzamide (PubChem CID 162372952) has the molecular formula C25H28F2N6O and a molecular weight of 466.54 g/mol. Its IUPAC name is N-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-4-(dimethylamino)-3,5-difluorobenzamide.
| Compound Name | N-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-4-(dimethylamino)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 162372952 |
| Molecular Formula | C25H28F2N6O |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | N-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-4-(dimethylamino)-3,5-difluorobenzamide |
| SMILES | CCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)c1cc(F)c(N(C)C)c(F)c1 |
| InChI | InChI=1S/C25H28F2N6O/c1-4-20-31-21-22(16-9-5-6-10-19(16)30-24(21)28)33(20)12-8-7-11-29-25(34)15-13-17(26)23(32(2)3)18(27)14-15/h5-6,9-10,13-14H,4,7-8,11-12H2,1-3H3,(H2,28,30)(H,29,34) |
| InChIKey | YEWVEAYENQORSE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|