C26H32N8O — CID 135317306
N-[4-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)butyl]-4-[(diaminomethylideneamino)methyl]benzamide (PubChem CID 135317306) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is N-[4-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)butyl]-4-[(diaminomethylideneamino)methyl]benzamide.
| Compound Name | N-[4-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)butyl]-4-[(diaminomethylideneamino)methyl]benzamide |
|---|---|
| PubChem CID | 135317306 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | N-[4-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)butyl]-4-[(diaminomethylideneamino)methyl]benzamide |
| SMILES | CCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)c1ccc(CN=C(N)N)cc1 |
| InChI | InChI=1S/C26H32N8O/c1-2-7-21-33-22-23(19-8-3-4-9-20(19)32-24(22)27)34(21)15-6-5-14-30-25(35)18-12-10-17(11-13-18)16-31-26(28)29/h3-4,8-13H,2,5-7,14-16H2,1H3,(H2,27,32)(H,30,35)(H4,28,29,31) |
| InChIKey | UAHAMZRRGCMCJJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|