C28H36N6O — CID 162737247
N-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-3-[4-(dimethylamino)phenyl]-2-methylpropanamide (PubChem CID 162737247) has the molecular formula C28H36N6O and a molecular weight of 472.64 g/mol. Its IUPAC name is N-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-3-[4-(dimethylamino)phenyl]-2-methylpropanamide.
| Compound Name | N-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-3-[4-(dimethylamino)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 162737247 |
| Molecular Formula | C28H36N6O |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | N-[4-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)butyl]-3-[4-(dimethylamino)phenyl]-2-methylpropanamide |
| SMILES | CCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)C(C)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C28H36N6O/c1-5-24-32-25-26(22-10-6-7-11-23(22)31-27(25)29)34(24)17-9-8-16-30-28(35)19(2)18-20-12-14-21(15-13-20)33(3)4/h6-7,10-15,19H,5,8-9,16-18H2,1-4H3,(H2,29,31)(H,30,35) |
| InChIKey | XZQXJPQRNYJLFW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|