C26H36N6O2 — CID 161339693
1-[4-[4-amino-2-[(4-methoxyphenyl)methyl]imidazo[4,5-c]quinolin-1-yl]butyl]-3-propylurea;molecular hydrogen (PubChem CID 161339693) has the molecular formula C26H36N6O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 1-[4-[4-amino-2-[(4-methoxyphenyl)methyl]imidazo[4,5-c]quinolin-1-yl]butyl]-3-propylurea;molecular hydrogen.
| Compound Name | 1-[4-[4-amino-2-[(4-methoxyphenyl)methyl]imidazo[4,5-c]quinolin-1-yl]butyl]-3-propylurea;molecular hydrogen |
|---|---|
| PubChem CID | 161339693 |
| Molecular Formula | C26H36N6O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 1-[4-[4-amino-2-[(4-methoxyphenyl)methyl]imidazo[4,5-c]quinolin-1-yl]butyl]-3-propylurea;molecular hydrogen |
| SMILES | CCCNC(=O)NCCCCn1c(Cc2ccc(OC)cc2)nc2c(N)nc3ccccc3c21.[H][H].[H][H] |
| InChI | InChI=1S/C26H32N6O2.2H2/c1-3-14-28-26(33)29-15-6-7-16-32-22(17-18-10-12-19(34-2)13-11-18)31-23-24(32)20-8-4-5-9-21(20)30-25(23)27;;/h4-5,8-13H,3,6-7,14-17H2,1-2H3,(H2,27,30)(H2,28,29,33);2*1H |
| InChIKey | VMMSCWBPDOPLTO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|