C33H33N5O2 — CID 152509827
2-[4-[4-amino-2-[(4-methoxyphenyl)methyl]imidazo[4,5-c]quinolin-1-yl]butyl]-1H-naphthalene-2-carboxamide (PubChem CID 152509827) has the molecular formula C33H33N5O2 and a molecular weight of 531.66 g/mol. Its IUPAC name is 2-[4-[4-amino-2-[(4-methoxyphenyl)methyl]imidazo[4,5-c]quinolin-1-yl]butyl]-1H-naphthalene-2-carboxamide.
| Compound Name | 2-[4-[4-amino-2-[(4-methoxyphenyl)methyl]imidazo[4,5-c]quinolin-1-yl]butyl]-1H-naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 152509827 |
| Molecular Formula | C33H33N5O2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 2-[4-[4-amino-2-[(4-methoxyphenyl)methyl]imidazo[4,5-c]quinolin-1-yl]butyl]-1H-naphthalene-2-carboxamide |
| SMILES | COc1ccc(Cc2nc3c(N)nc4ccccc4c3n2CCCCC2(C(N)=O)C=Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C33H33N5O2/c1-40-25-14-12-22(13-15-25)20-28-37-29-30(26-10-4-5-11-27(26)36-31(29)34)38(28)19-7-6-17-33(32(35)39)18-16-23-8-2-3-9-24(23)21-33/h2-5,8-16,18H,6-7,17,19-21H2,1H3,(H2,34,36)(H2,35,39) |
| InChIKey | YFGFCKDGUJIMAT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|