C27H33N5O2 — CID 25106601
methyl 2-[4-[[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)propylamino]methyl]phenyl]acetate (PubChem CID 25106601) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is methyl 2-[4-[[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)propylamino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[4-[[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)propylamino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 25106601 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | methyl 2-[4-[[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)propylamino]methyl]phenyl]acetate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCNCc1ccc(CC(=O)OC)cc1 |
| InChI | InChI=1S/C27H33N5O2/c1-3-4-10-23-31-25-26(21-8-5-6-9-22(21)30-27(25)28)32(23)16-7-15-29-18-20-13-11-19(12-14-20)17-24(33)34-2/h5-6,8-9,11-14,29H,3-4,7,10,15-18H2,1-2H3,(H2,28,30) |
| InChIKey | XIQQEASYCSFTBJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|