C25H29N5O3 — CID 67227981
[3-[[3-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]propylamino]methyl]phenyl] acetate (PubChem CID 67227981) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is [3-[[3-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]propylamino]methyl]phenyl] acetate.
| Compound Name | [3-[[3-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]propylamino]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 67227981 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | [3-[[3-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]propylamino]methyl]phenyl] acetate |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCNCc1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C25H29N5O3/c1-17(31)33-19-8-5-7-18(15-19)16-27-12-6-13-30-22(11-14-32-2)29-23-24(30)20-9-3-4-10-21(20)28-25(23)26/h3-5,7-10,15,27H,6,11-14,16H2,1-2H3,(H2,26,28) |
| InChIKey | ADIHHYZQEJGVMF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|