C27H28N6O2 — CID 68818570
3-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]quinoline-2-carboxamide (PubChem CID 68818570) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]quinoline-2-carboxamide.
| Compound Name | 3-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 68818570 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 3-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]quinoline-2-carboxamide |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCc1cc2ccccc2nc1C(N)=O |
| InChI | InChI=1S/C27H28N6O2/c1-35-15-13-22-32-24-25(19-10-3-5-12-21(19)31-26(24)28)33(22)14-7-6-9-18-16-17-8-2-4-11-20(17)30-23(18)27(29)34/h2-5,8,10-12,16H,6-7,9,13-15H2,1H3,(H2,28,31)(H2,29,34) |
| InChIKey | ZPYHDCTXLGGXLP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|