C24H26F3N5O4S — CID 20714058
N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 20714058) has the molecular formula C24H26F3N5O4S and a molecular weight of 537.56 g/mol. Its IUPAC name is N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 20714058 |
| Molecular Formula | C24H26F3N5O4S |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCNS(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C24H26F3N5O4S/c1-35-15-12-20-31-21-22(16-8-2-3-9-17(16)30-23(21)28)32(20)14-7-6-13-29-37(33,34)19-11-5-4-10-18(19)36-24(25,26)27/h2-5,8-11,29H,6-7,12-15H2,1H3,(H2,28,30) |
| InChIKey | VJFABMJFIQLAFR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|