C25H31F3N6O2 — CID 162183695
1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-[3-(trifluoromethyl)phenyl]urea;molecular hydrogen (PubChem CID 162183695) has the molecular formula C25H31F3N6O2 and a molecular weight of 504.56 g/mol. Its IUPAC name is 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-[3-(trifluoromethyl)phenyl]urea;molecular hydrogen.
| Compound Name | 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-[3-(trifluoromethyl)phenyl]urea;molecular hydrogen |
|---|---|
| PubChem CID | 162183695 |
| Molecular Formula | C25H31F3N6O2 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-[3-(trifluoromethyl)phenyl]urea;molecular hydrogen |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)Nc1cccc(C(F)(F)F)c1.[H][H].[H][H] |
| InChI | InChI=1S/C25H27F3N6O2.2H2/c1-36-14-11-20-33-21-22(18-9-2-3-10-19(18)32-23(21)29)34(20)13-5-4-12-30-24(35)31-17-8-6-7-16(15-17)25(26,27)28;;/h2-3,6-10,15H,4-5,11-14H2,1H3,(H2,29,32)(H2,30,31,35);2*1H |
| InChIKey | ZPJNDTOUCZZWQX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|