C23H27N7OS — CID 23497578
1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-pyridin-3-ylthiourea (PubChem CID 23497578) has the molecular formula C23H27N7OS and a molecular weight of 449.58 g/mol. Its IUPAC name is 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 23497578 |
| Molecular Formula | C23H27N7OS |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-pyridin-3-ylthiourea |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=S)Nc1cccnc1 |
| InChI | InChI=1S/C23H27N7OS/c1-31-14-10-19-29-20-21(17-8-2-3-9-18(17)28-22(20)24)30(19)13-5-4-12-26-23(32)27-16-7-6-11-25-15-16/h2-3,6-9,11,15H,4-5,10,12-14H2,1H3,(H2,24,28)(H2,26,27,32) |
| InChIKey | NPXMDLDRTNPBGV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|