C23H27N5O3S2 — CID 87579353
N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-6-sulfanylidenecyclohexa-1,3-diene-1-sulfonamide (PubChem CID 87579353) has the molecular formula C23H27N5O3S2 and a molecular weight of 485.64 g/mol. Its IUPAC name is N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-6-sulfanylidenecyclohexa-1,3-diene-1-sulfonamide.
| Compound Name | N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-6-sulfanylidenecyclohexa-1,3-diene-1-sulfonamide |
|---|---|
| PubChem CID | 87579353 |
| Molecular Formula | C23H27N5O3S2 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-6-sulfanylidenecyclohexa-1,3-diene-1-sulfonamide |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCNS(=O)(=O)C1=CC=CCC1=S |
| InChI | InChI=1S/C23H27N5O3S2/c1-31-15-12-20-27-21-22(16-8-2-3-9-17(16)26-23(21)24)28(20)14-7-6-13-25-33(29,30)19-11-5-4-10-18(19)32/h2-5,8-9,11,25H,6-7,10,12-15H2,1H3,(H2,24,26) |
| InChIKey | ZDPUXMBFGAXIMW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|