C23H25Cl2N5OS — CID 142033055
1-[4-[(2,6-dichlorophenyl)sulfanylamino]butyl]-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-4-amine (PubChem CID 142033055) has the molecular formula C23H25Cl2N5OS and a molecular weight of 490.46 g/mol. Its IUPAC name is 1-[4-[(2,6-dichlorophenyl)sulfanylamino]butyl]-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[4-[(2,6-dichlorophenyl)sulfanylamino]butyl]-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 142033055 |
| Molecular Formula | C23H25Cl2N5OS |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 1-[4-[(2,6-dichlorophenyl)sulfanylamino]butyl]-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-4-amine |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCNSc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H25Cl2N5OS/c1-31-14-11-19-29-20-21(15-7-2-3-10-18(15)28-23(20)26)30(19)13-5-4-12-27-32-22-16(24)8-6-9-17(22)25/h2-3,6-10,27H,4-5,11-14H2,1H3,(H2,26,28) |
| InChIKey | ITPVKNJNYCKQSM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|