C28H32N6OS — CID 142033120
2-[4-amino-1-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]butyl]imidazo[4,5-c]quinolin-2-yl]ethanol (PubChem CID 142033120) has the molecular formula C28H32N6OS and a molecular weight of 500.67 g/mol. Its IUPAC name is 2-[4-amino-1-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]butyl]imidazo[4,5-c]quinolin-2-yl]ethanol.
| Compound Name | 2-[4-amino-1-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]butyl]imidazo[4,5-c]quinolin-2-yl]ethanol |
|---|---|
| PubChem CID | 142033120 |
| Molecular Formula | C28H32N6OS |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 2-[4-amino-1-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]butyl]imidazo[4,5-c]quinolin-2-yl]ethanol |
| SMILES | CN(C)c1cccc2c(SNCCCCn3c(CCO)nc4c(N)nc5ccccc5c43)cccc12 |
| InChI | InChI=1S/C28H32N6OS/c1-33(2)23-13-7-11-20-19(23)10-8-14-24(20)36-30-16-5-6-17-34-25(15-18-35)32-26-27(34)21-9-3-4-12-22(21)31-28(26)29/h3-4,7-14,30,35H,5-6,15-18H2,1-2H3,(H2,29,31) |
| InChIKey | YBCXXFDXNIQPSK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|