C16H21N5O — CID 143284618
2-[4-amino-1-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-2-yl]ethanol (PubChem CID 143284618) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-[4-amino-1-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-2-yl]ethanol.
| Compound Name | 2-[4-amino-1-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-2-yl]ethanol |
|---|---|
| PubChem CID | 143284618 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-[4-amino-1-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-2-yl]ethanol |
| SMILES | CNCCCn1c(CCO)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C16H21N5O/c1-18-8-4-9-21-13(7-10-22)20-14-15(21)11-5-2-3-6-12(11)19-16(14)17/h2-3,5-6,18,22H,4,7-10H2,1H3,(H2,17,19) |
| InChIKey | BSXPHXMSSMJIGF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|