C26H31N5O4 — CID 67227454
2-[3-[[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethylamino]methyl]phenoxy]-2-methylpropanoic acid (PubChem CID 67227454) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is 2-[3-[[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethylamino]methyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethylamino]methyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 67227454 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 2-[3-[[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethylamino]methyl]phenoxy]-2-methylpropanoic acid |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCNCc1cccc(OC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C26H31N5O4/c1-26(2,25(32)33)35-18-8-6-7-17(15-18)16-28-12-13-31-21(11-14-34-3)30-22-23(31)19-9-4-5-10-20(19)29-24(22)27/h4-10,15,28H,11-14,16H2,1-3H3,(H2,27,29)(H,32,33) |
| InChIKey | WPYQQENKLAIHQF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|