C27H33N5O3 — CID 58294735
3-[3-[[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethylamino]methyl]phenoxy]-3-methylbutan-2-one (PubChem CID 58294735) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is 3-[3-[[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethylamino]methyl]phenoxy]-3-methylbutan-2-one.
| Compound Name | 3-[3-[[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethylamino]methyl]phenoxy]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 58294735 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 3-[3-[[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethylamino]methyl]phenoxy]-3-methylbutan-2-one |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCNCc1cccc(OC(C)(C)C(C)=O)c1 |
| InChI | InChI=1S/C27H33N5O3/c1-18(33)27(2,3)35-20-9-7-8-19(16-20)17-29-13-14-32-23(12-15-34-4)31-24-25(32)21-10-5-6-11-22(21)30-26(24)28/h5-11,16,29H,12-15,17H2,1-4H3,(H2,28,30) |
| InChIKey | KYEROVPWMIVRGS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|