C31H40N6O5 — CID 87316531
2-[3-[[acetyl-[3-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]propyl]-(diethylamino)azaniumyl]methyl]phenoxy]acetate (PubChem CID 87316531) has the molecular formula C31H40N6O5 and a molecular weight of 576.70 g/mol. Its IUPAC name is 2-[3-[[acetyl-[3-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]propyl]-(diethylamino)azaniumyl]methyl]phenoxy]acetate.
| Compound Name | 2-[3-[[acetyl-[3-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]propyl]-(diethylamino)azaniumyl]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 87316531 |
| Molecular Formula | C31H40N6O5 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 2-[3-[[acetyl-[3-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]propyl]-(diethylamino)azaniumyl]methyl]phenoxy]acetate |
| SMILES | CCN(CC)[N+](CCCn1c(CCOC)nc2c(N)nc3ccccc3c21)(Cc1cccc(OCC(=O)[O-])c1)C(C)=O |
| InChI | InChI=1S/C31H40N6O5/c1-5-35(6-2)37(22(3)38,20-23-11-9-12-24(19-23)42-21-28(39)40)17-10-16-36-27(15-18-41-4)34-29-30(36)25-13-7-8-14-26(25)33-31(29)32/h7-9,11-14,19H,5-6,10,15-18,20-21H2,1-4H3,(H2-,32,33,39,40) |
| InChIKey | FGUMJKIJORSTNX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|