C24H32N6OS — CID 23497561
1-[4-[4-amino-2-(2-methoxyethyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-1-yl]butyl]-3-phenylthiourea (PubChem CID 23497561) has the molecular formula C24H32N6OS and a molecular weight of 452.63 g/mol. Its IUPAC name is 1-[4-[4-amino-2-(2-methoxyethyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-1-yl]butyl]-3-phenylthiourea.
| Compound Name | 1-[4-[4-amino-2-(2-methoxyethyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-1-yl]butyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 23497561 |
| Molecular Formula | C24H32N6OS |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 1-[4-[4-amino-2-(2-methoxyethyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-1-yl]butyl]-3-phenylthiourea |
| SMILES | COCCc1nc2c(N)nc3c(c2n1CCCCNC(=S)Nc1ccccc1)CCCC3 |
| InChI | InChI=1S/C24H32N6OS/c1-31-16-13-20-29-21-22(18-11-5-6-12-19(18)28-23(21)25)30(20)15-8-7-14-26-24(32)27-17-9-3-2-4-10-17/h2-4,9-10H,5-8,11-16H2,1H3,(H2,25,28)(H2,26,27,32) |
| InChIKey | FGDCEHUKYFFYSG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|