C25H35N5O2S — CID 20713981
N-[4-(4-amino-2-butyl-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-1-yl)butyl]-1-phenylmethanesulfonamide (PubChem CID 20713981) has the molecular formula C25H35N5O2S and a molecular weight of 469.66 g/mol. Its IUPAC name is N-[4-(4-amino-2-butyl-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-1-yl)butyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[4-(4-amino-2-butyl-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-1-yl)butyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 20713981 |
| Molecular Formula | C25H35N5O2S |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[4-(4-amino-2-butyl-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-1-yl)butyl]-1-phenylmethanesulfonamide |
| SMILES | CCCCc1nc2c(N)nc3c(c2n1CCCCNS(=O)(=O)Cc1ccccc1)CCCC3 |
| InChI | InChI=1S/C25H35N5O2S/c1-2-3-15-22-29-23-24(20-13-7-8-14-21(20)28-25(23)26)30(22)17-10-9-16-27-33(31,32)18-19-11-5-4-6-12-19/h4-6,11-12,27H,2-3,7-10,13-18H2,1H3,(H2,26,28) |
| InChIKey | HOPQQFDJLLCGHI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|