C23H27N5O4S — CID 175017580
N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-(1,1-dioxothiophen-3-yl)acetamide (PubChem CID 175017580) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-(1,1-dioxothiophen-3-yl)acetamide.
| Compound Name | N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-(1,1-dioxothiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 175017580 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-(1,1-dioxothiophen-3-yl)acetamide |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCN(C(C)=O)C1=CS(=O)(=O)C=C1 |
| InChI | InChI=1S/C23H27N5O4S/c1-16(29)27(17-10-14-33(30,31)15-17)11-5-6-12-28-20(9-13-32-2)26-21-22(28)18-7-3-4-8-19(18)25-23(21)24/h3-4,7-8,10,14-15H,5-6,9,11-13H2,1-2H3,(H2,24,25) |
| InChIKey | UQIBZGDUTHPTQD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|