C27H35N7O5S — CID 67222529
N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-[2-(dimethylamino)ethyl]-2-nitrobenzenesulfonamide (PubChem CID 67222529) has the molecular formula C27H35N7O5S and a molecular weight of 569.69 g/mol. Its IUPAC name is N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-[2-(dimethylamino)ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-[2-(dimethylamino)ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67222529 |
| Molecular Formula | C27H35N7O5S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | N-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-[2-(dimethylamino)ethyl]-2-nitrobenzenesulfonamide |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCN(CCN(C)C)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H35N7O5S/c1-31(2)17-18-32(40(37,38)23-13-7-6-12-22(23)34(35)36)15-8-9-16-33-24(14-19-39-3)30-25-26(33)20-10-4-5-11-21(20)29-27(25)28/h4-7,10-13H,8-9,14-19H2,1-3H3,(H2,28,29) |
| InChIKey | MWSPQLKKHVFJQB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|