C25H31N5O2 — CID 150842471
1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-6-methylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 150842471) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-6-methylcyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-6-methylcyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 150842471 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-6-methylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCC1(C(N)=O)C=CC=CC1C |
| InChI | InChI=1S/C25H31N5O2/c1-17-9-5-6-13-25(17,24(27)31)14-7-8-15-30-20(12-16-32-2)29-21-22(30)18-10-3-4-11-19(18)28-23(21)26/h3-6,9-11,13,17H,7-8,12,14-16H2,1-2H3,(H2,26,28)(H2,27,31) |
| InChIKey | KOHAZYFEOJOPSP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|