C24H25IN4O — CID 69080447
2-ethyl-1-[5-(4-methoxyphenyl)pent-4-ynyl]imidazo[4,5-c]quinolin-4-amine;hydroiodide (PubChem CID 69080447) has the molecular formula C24H25IN4O and a molecular weight of 512.40 g/mol. Its IUPAC name is 2-ethyl-1-[5-(4-methoxyphenyl)pent-4-ynyl]imidazo[4,5-c]quinolin-4-amine;hydroiodide.
| Compound Name | 2-ethyl-1-[5-(4-methoxyphenyl)pent-4-ynyl]imidazo[4,5-c]quinolin-4-amine;hydroiodide |
|---|---|
| PubChem CID | 69080447 |
| Molecular Formula | C24H25IN4O |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 2-ethyl-1-[5-(4-methoxyphenyl)pent-4-ynyl]imidazo[4,5-c]quinolin-4-amine;hydroiodide |
| SMILES | CCc1nc2c(N)nc3ccccc3c2n1CCCC#Cc1ccc(OC)cc1.I |
| InChI | InChI=1S/C24H24N4O.HI/c1-3-21-27-22-23(19-10-6-7-11-20(19)26-24(22)25)28(21)16-8-4-5-9-17-12-14-18(29-2)15-13-17;/h6-7,10-15H,3-4,8,16H2,1-2H3,(H2,25,26);1H |
| InChIKey | KEJIYDXTOVEECS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|