C27H38N6O — CID 158694764
1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-[(3-methylphenyl)methyl]urea;molecular hydrogen (PubChem CID 158694764) has the molecular formula C27H38N6O and a molecular weight of 462.64 g/mol. Its IUPAC name is 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-[(3-methylphenyl)methyl]urea;molecular hydrogen.
| Compound Name | 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-[(3-methylphenyl)methyl]urea;molecular hydrogen |
|---|---|
| PubChem CID | 158694764 |
| Molecular Formula | C27H38N6O |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-[(3-methylphenyl)methyl]urea;molecular hydrogen |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)NCc1cccc(C)c1.[H][H].[H][H] |
| InChI | InChI=1S/C27H34N6O.2H2/c1-3-4-14-23-32-24-25(21-12-5-6-13-22(21)31-26(24)28)33(23)16-8-7-15-29-27(34)30-18-20-11-9-10-19(2)17-20;;/h5-6,9-13,17H,3-4,7-8,14-16,18H2,1-2H3,(H2,28,31)(H2,29,30,34);2*1H |
| InChIKey | IGUKNNZYMZPQDT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|