C22H33N7O — CID 10001667
1-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-3-butylurea (PubChem CID 10001667) has the molecular formula C22H33N7O and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-3-butylurea.
| Compound Name | 1-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-3-butylurea |
|---|---|
| PubChem CID | 10001667 |
| Molecular Formula | C22H33N7O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | 1-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-3-butylurea |
| SMILES | CCCCNC(=O)NCCCCn1c(CCCC)nc2c(N)nc3cccnc3c21 |
| InChI | InChI=1S/C22H33N7O/c1-3-5-11-17-28-19-20(18-16(27-21(19)23)10-9-14-24-18)29(17)15-8-7-13-26-22(30)25-12-6-4-2/h9-10,14H,3-8,11-13,15H2,1-2H3,(H2,23,27)(H2,25,26,30) |
| InChIKey | RKHPJMXDRRZPGD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|