C19H26N6O — CID 20628617
N-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]acetamide (PubChem CID 20628617) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is N-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]acetamide.
| Compound Name | N-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]acetamide |
|---|---|
| PubChem CID | 20628617 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | N-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]acetamide |
| SMILES | CCCCc1nc2c(N)nc3cccnc3c2n1CCCCNC(C)=O |
| InChI | InChI=1S/C19H26N6O/c1-3-4-9-15-24-17-18(25(15)12-6-5-10-21-13(2)26)16-14(23-19(17)20)8-7-11-22-16/h7-8,11H,3-6,9-10,12H2,1-2H3,(H2,20,23)(H,21,26) |
| InChIKey | YBNRKBUYCYBJAR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|