C22H32N4S — CID 10287302
2-butyl-1-(4-tert-butylsulfanylbutyl)imidazo[4,5-c]quinolin-4-amine (PubChem CID 10287302) has the molecular formula C22H32N4S and a molecular weight of 384.59 g/mol. Its IUPAC name is 2-butyl-1-(4-tert-butylsulfanylbutyl)imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-butyl-1-(4-tert-butylsulfanylbutyl)imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 10287302 |
| Molecular Formula | C22H32N4S |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-butyl-1-(4-tert-butylsulfanylbutyl)imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCSC(C)(C)C |
| InChI | InChI=1S/C22H32N4S/c1-5-6-13-18-25-19-20(16-11-7-8-12-17(16)24-21(19)23)26(18)14-9-10-15-27-22(2,3)4/h7-8,11-12H,5-6,9-10,13-15H2,1-4H3,(H2,23,24) |
| InChIKey | WJZZAWGYEFFFES-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|