C19H26N4S — CID 166933556
3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropane-1-thiol (PubChem CID 166933556) has the molecular formula C19H26N4S and a molecular weight of 342.51 g/mol. Its IUPAC name is 3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropane-1-thiol.
| Compound Name | 3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropane-1-thiol |
|---|---|
| PubChem CID | 166933556 |
| Molecular Formula | C19H26N4S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropane-1-thiol |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)CS |
| InChI | InChI=1S/C19H26N4S/c1-4-5-10-15-22-16-17(23(15)11-19(2,3)12-24)13-8-6-7-9-14(13)21-18(16)20/h6-9,24H,4-5,10-12H2,1-3H3,(H2,20,21) |
| InChIKey | XWQQXKQHKJVSAH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|