C22H31N5O2 — CID 167498100
N-[2-[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropoxy]ethyl]formamide (PubChem CID 167498100) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[2-[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropoxy]ethyl]formamide.
| Compound Name | N-[2-[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropoxy]ethyl]formamide |
|---|---|
| PubChem CID | 167498100 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-[2-[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropoxy]ethyl]formamide |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)COCCNC=O |
| InChI | InChI=1S/C22H31N5O2/c1-4-5-10-18-26-19-20(16-8-6-7-9-17(16)25-21(19)23)27(18)13-22(2,3)14-29-12-11-24-15-28/h6-9,15H,4-5,10-14H2,1-3H3,(H2,23,25)(H,24,28) |
| InChIKey | LOUJSVSUXHQBLU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|