C22H30N4O3S — CID 176816821
[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropyl] 2-sulfanylethyl carbonate (PubChem CID 176816821) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is [3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropyl] 2-sulfanylethyl carbonate.
| Compound Name | [3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropyl] 2-sulfanylethyl carbonate |
|---|---|
| PubChem CID | 176816821 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropyl] 2-sulfanylethyl carbonate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)COC(=O)OCCS |
| InChI | InChI=1S/C22H30N4O3S/c1-4-5-10-17-25-18-19(15-8-6-7-9-16(15)24-20(18)23)26(17)13-22(2,3)14-29-21(27)28-11-12-30/h6-9,30H,4-5,10-14H2,1-3H3,(H2,23,24) |
| InChIKey | VFGNLLWGMUUCOV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|