C26H41N5O3 — CID 144759222
4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl carbamate;2,2-dimethylpentane (PubChem CID 144759222) has the molecular formula C26H41N5O3 and a molecular weight of 471.65 g/mol. Its IUPAC name is 4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl carbamate;2,2-dimethylpentane.
| Compound Name | 4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl carbamate;2,2-dimethylpentane |
|---|---|
| PubChem CID | 144759222 |
| Molecular Formula | C26H41N5O3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl carbamate;2,2-dimethylpentane |
| SMILES | CCCC(C)(C)C.CCCCc1nc2c(N)nc3ccccc3c2n1OCCCCOC(N)=O |
| InChI | InChI=1S/C19H25N5O3.C7H16/c1-2-3-10-15-23-16-17(13-8-4-5-9-14(13)22-18(16)20)24(15)27-12-7-6-11-26-19(21)25;1-5-6-7(2,3)4/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H2,20,22)(H2,21,25);5-6H2,1-4H3 |
| InChIKey | GKLMKEQZANANER-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|