C22H29N5O5 — CID 66765685
1-(4-aminobutoxy)-2-butylimidazo[4,5-c]quinolin-4-amine;(E)-but-2-enedioic acid (PubChem CID 66765685) has the molecular formula C22H29N5O5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 1-(4-aminobutoxy)-2-butylimidazo[4,5-c]quinolin-4-amine;(E)-but-2-enedioic acid.
| Compound Name | 1-(4-aminobutoxy)-2-butylimidazo[4,5-c]quinolin-4-amine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 66765685 |
| Molecular Formula | C22H29N5O5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-(4-aminobutoxy)-2-butylimidazo[4,5-c]quinolin-4-amine;(E)-but-2-enedioic acid |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1OCCCCN.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H25N5O.C4H4O4/c1-2-3-10-15-22-16-17(23(15)24-12-7-6-11-19)13-8-4-5-9-14(13)21-18(16)20;5-3(6)1-2-4(7)8/h4-5,8-9H,2-3,6-7,10-12,19H2,1H3,(H2,20,21);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XTMUZOJPUCWVLY-WLHGVMLRSA-N |
| XLogP | 2.39 |
| TPSA | 166.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|