C21H28N4O2S — CID 130233004
S-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl] propanethioate (PubChem CID 130233004) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is S-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl] propanethioate.
| Compound Name | S-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl] propanethioate |
|---|---|
| PubChem CID | 130233004 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | S-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl] propanethioate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1OCCCCSC(=O)CC |
| InChI | InChI=1S/C21H28N4O2S/c1-3-5-12-17-24-19-20(15-10-6-7-11-16(15)23-21(19)22)25(17)27-13-8-9-14-28-18(26)4-2/h6-7,10-11H,3-5,8-9,12-14H2,1-2H3,(H2,22,23) |
| InChIKey | FGIUUISKAPFRHY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|