C20H27N5O2S — CID 166661227
S-methyl N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]carbamothioate (PubChem CID 166661227) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is S-methyl N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]carbamothioate.
| Compound Name | S-methyl N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]carbamothioate |
|---|---|
| PubChem CID | 166661227 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | S-methyl N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)oxybutyl]carbamothioate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1OCCCCNC(=O)SC |
| InChI | InChI=1S/C20H27N5O2S/c1-3-4-11-16-24-17-18(14-9-5-6-10-15(14)23-19(17)21)25(16)27-13-8-7-12-22-20(26)28-2/h5-6,9-10H,3-4,7-8,11-13H2,1-2H3,(H2,21,23)(H,22,26) |
| InChIKey | ILIABXIYICXPIJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|